| Name | 1,5-Dichloro-2,4-dinitrobenzene |
| Synonyms | LABOTEST-BB LT00848199 1,3-Dichloro-4,6-dinitrobenzene 1,5-dinitro-2,4-dichlorobenzene 2,4-Dichloro-1,5-dinitrobenzene 1,5-Dichloro-2,4-dinitrobenzene 1,5-dichloro-2,4-dinitro-benzen 1,5-DICHLORO-2,4-DINITROBENZENE 1,3-DICHLORO-4,6-DINITROBENZENE Benzene, 1,5-dichloro-2,4-dinitro- Benzene, 1,3-dichloro-4,6-dinitro- |
| CAS | 3698-83-7 |
| EINECS | 223-027-1 |
| InChI | InChI=1/C6H2Cl2N2O4/c7-3-1-4(8)6(10(13)14)2-5(3)9(11)12/h1-2H |
| InChIKey | ZPXDNSYFDIHPOJ-UHFFFAOYSA-N |
| Molecular Formula | C6H2Cl2N2O4 |
| Molar Mass | 237 |
| Density | 1.729±0.06 g/cm3(Predicted) |
| Melting Point | 101-104°C(lit.) |
| Boling Point | 337.6±37.0 °C(Predicted) |
| Flash Point | 158°C |
| Water Solubility | Insoluble in water. |
| Solubility | soluble in Toluene |
| Vapor Presure | 0.000203mmHg at 25°C |
| Appearance | Crystallization |
| Color | Light orange to Yellow to Green |
| BRN | 1685438 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.636 |
| MDL | MFCD00024186 |
| Risk Codes | 50 - Very Toxic to aquatic organisms |
| Safety Description | 61 - Avoid release to the environment. Refer to special instructions / safety data sheets. |
| UN IDs | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29049090 |
| Hazard Class | 6.1 |
| Packing Group | III |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |